cas: 951163-61-4 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl N-[(3S,5S)-5-methyl-3-piperidinyl]carbamate, 98%, 98% (CAS 951163-61-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FZ2Q-10g |
| cas | 951163-61-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2094.80 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 500mg | 510.80 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1173.20 Pln | |
| Chemat | 25g | 2694.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate (CAS 951163-61-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-IUCAKERBSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)