cas: 951163-61-4 — see every product listed under this CAS number, including other names
tert-Butyl ((3S,5S)-5-methylpiperidin-3-yl)carbamate, 98% (CAS 951163-61-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F604876-250MG |
| cas | 951163-61-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 2361.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate (CAS 951163-61-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-IUCAKERBSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3S,5S)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)