cas: 7668-28-2 — see every product listed under this CAS number, including other names
1,1-Dioxo-1H-1lambda*6*-benzo[d]isothiazol-3-ylamine, 98% (CAS 7668-28-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059622-250MG |
| cas | 7668-28-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 2.5g | 778.91 Pln | |
| Fluorochem | 5g | 1138.16 Pln | |
| Fluorochem | 10g | 2226.32 Pln | |
| Fluorochem | 25g | 5480.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,1-dioxo-1,2-benzothiazol-3-amine (CAS 7668-28-2) is a chemical compound with the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. IUPAC name: 1,1-dioxo-1,2-benzothiazol-3-amine. InChIKey: QNOQSOJREDRYBC-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 1,1-dioxo-1,2-benzothiazol-3-amine |
| InChIKey | QNOQSOJREDRYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)N |
Computed by PubChem (NCBI)