cas: 7668-28-2 — see every product listed under this CAS number, including other names
3-Aminobenzo(d)isothiazole 1,1-dioxide, 95+% (CAS 7668-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A127163-1g |
| cas | 7668-28-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 1026.97 Pln | |
| AmBeed | 250mg | 402.01 Pln | |
| AmBeed | 100mg | 278.32 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,1-dioxo-1,2-benzothiazol-3-amine (CAS 7668-28-2) is a chemical compound with the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. IUPAC name: 1,1-dioxo-1,2-benzothiazol-3-amine. InChIKey: QNOQSOJREDRYBC-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 1,1-dioxo-1,2-benzothiazol-3-amine |
| InChIKey | QNOQSOJREDRYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)N |
Computed by PubChem (NCBI)