cas: 7668-28-2 — see every product listed under this CAS number, including other names
3-Aminobenzo[d]isothiazole 1,1-dioxide, 98%, 98% (CAS 7668-28-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116W2J-100mg |
| cas | 7668-28-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1312.40 Pln | |
| Chemat | 10g | 2560.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,1-dioxo-1,2-benzothiazol-3-amine (CAS 7668-28-2) is a chemical compound with the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. IUPAC name: 1,1-dioxo-1,2-benzothiazol-3-amine. InChIKey: QNOQSOJREDRYBC-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 1,1-dioxo-1,2-benzothiazol-3-amine |
| InChIKey | QNOQSOJREDRYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)N |
Computed by PubChem (NCBI)