cas: 2465-93-2 — see every product listed under this CAS number, including other names
1,2,3-Tris(2-cyanoethoxy)propane, 95%, 95% (CAS 2465-93-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OXY-1g |
| cas | 2465-93-2 |
| size | 1g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 208.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2,3-bis(2-cyanoethoxy)propoxy]propanenitrile (CAS 2465-93-2) is a chemical compound with the molecular formula C12H17N3O3 and a molecular weight of 251.28 g/mol. IUPAC name: 3-[2,3-bis(2-cyanoethoxy)propoxy]propanenitrile. InChIKey: ALGVJKNIAOBBBJ-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 3-[2,3-bis(2-cyanoethoxy)propoxy]propanenitrile |
| InChIKey | ALGVJKNIAOBBBJ-UHFFFAOYSA-N |
| SMILES | C(COCC(COCCC#N)OCCC#N)C#N |
Computed by PubChem (NCBI)