CAS 77755-81-8 appears in our catalog under these names: N-(2-(morpholinoethyl)-4-nitroaniline, 96%, N–(2–Morpholinoethyl)–4–nitroaniline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 100g, 1g, 25g, 100mg.
N-(2-morpholin-4-ylethyl)-4-nitroaniline (CAS 77755-81-8) is a chemical compound with the molecular formula C12H17N3O3 and a molecular weight of 251.28 g/mol. IUPAC name: N-(2-morpholin-4-ylethyl)-4-nitroaniline. InChIKey: NWUVRJDVZZNZGH-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | N-(2-morpholin-4-ylethyl)-4-nitroaniline |
| InChIKey | NWUVRJDVZZNZGH-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCNC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)