Products 70324-66-2
CAS 70324-66-2 appears in our catalog under these names: H-Ile-pna, 98%, H–Ile–pNA, H-L-Ile-pNA, H-Ile-pNA 97%, H-ILE-PNA, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
(2S,3S)-2-amino-3-methyl-N-(4-nitrophenyl)pentanamide (CAS 70324-66-2) is a chemical compound with the molecular formula C12H17N3O3 and a molecular weight of 251.28 g/mol. IUPAC name: (2S,3S)-2-amino-3-methyl-N-(4-nitrophenyl)pentanamide. InChIKey: NCCAUSZFESISCS-KWQFWETISA-N.
| Molecular formula | C12H17N3O3 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-methyl-N-(4-nitrophenyl)pentanamide |
| InChIKey | NCCAUSZFESISCS-KWQFWETISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)