cas: 636-28-2 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrabromobenzene, 98%, 98% (CAS 636-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 10kg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DAT-1kg |
| cas | 636-28-2 |
| size | 1kg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 3419.60 Pln | |
| Chemat | 5kg | 17040.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 174.80 Pln | |
| Chemat | 100g | 506.00 Pln | |
| Chemat | 500g | 2361.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,4,5-tetrabromobenzene (CAS 636-28-2) is a chemical compound with the molecular formula C6H2Br4 and a molecular weight of 393.70 g/mol. IUPAC name: 1,2,4,5-tetrabromobenzene. InChIKey: QCKHVNQHBOGZER-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4 |
|---|---|
| Molecular weight | 393.70 g/mol |
| IUPAC name | 1,2,4,5-tetrabromobenzene |
| InChIKey | QCKHVNQHBOGZER-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)Br)Br |
Computed by PubChem (NCBI)