CAS 636-28-2 appears in our catalog under these names: 1,2,4,5-Tetrabromobenzene, 1,2,4,5-Tetrabromobenzene, >95% (HPLC), 1,2,4,5–Tetrabromobenzene, 1,2,4,5-Tetrabromobenzene, 94% , 1,2,4,5-Tetrabromobenzene, >97.0%(GC). Offered by: Dr. Ehrenstorfer, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 2,5g, 25g, 50g, 100g, 10g, 5g, 1000g.
1,2,4,5-tetrabromobenzene (CAS 636-28-2) is a chemical compound with the molecular formula C6H2Br4 and a molecular weight of 393.70 g/mol. IUPAC name: 1,2,4,5-tetrabromobenzene. InChIKey: QCKHVNQHBOGZER-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4 |
|---|---|
| Molecular weight | 393.70 g/mol |
| IUPAC name | 1,2,4,5-tetrabromobenzene |
| InChIKey | QCKHVNQHBOGZER-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)Br)Br |
Computed by PubChem (NCBI)