CAS 634-89-9 appears in our catalog under these names: 1,2,3,5-tetrabromobenzene, 1,2,3,5-Tetrabromobenzene, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
1,2,3,5-tetrabromobenzene (CAS 634-89-9) is a chemical compound with the molecular formula C6H2Br4 and a molecular weight of 393.70 g/mol. IUPAC name: 1,2,3,5-tetrabromobenzene. InChIKey: YPFCYPZKFQPCOC-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4 |
|---|---|
| Molecular weight | 393.70 g/mol |
| IUPAC name | 1,2,3,5-tetrabromobenzene |
| InChIKey | YPFCYPZKFQPCOC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Br)Br)Br |
Computed by PubChem (NCBI)