1,2-BIS(BROMOMETHYL)-4,5-DIMETHOXYBENZENE, 98%
cas: 26726-81-8 — see every product listed under this CAS number, including other names
1,2-BIS(BROMOMETHYL)-4,5-DIMETHOXYBENZENE, 98% (CAS 26726-81-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F332877-250MG |
| cas | 26726-81-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 5g | 6568.54 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1182.50 Pln | |
| Ambeed | 5g | 4892.69 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 5g | 4667.60 Pln | |
| BLDpharm | 250mg | 492.07 Pln | |
| BLDpharm | 1g | 1158.51 Pln | |
| BLDpharm | 5g | 4796.11 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1,2-bis(bromomethyl)-4,5-dimethoxybenzene (CAS 26726-81-8) is a chemical compound with the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. IUPAC name: 1,2-bis(bromomethyl)-4,5-dimethoxybenzene. InChIKey: ARGOTHVUUGQGPD-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O2 |
|---|---|
| Molecular weight | 324.01 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)-4,5-dimethoxybenzene |
| InChIKey | ARGOTHVUUGQGPD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CBr)CBr)OC |
Computed by PubChem (NCBI)