CAS 1696709-12-2 appears in our catalog under these names: [3,5-Dibromo-4-(propan-2-yloxy)phenyl]methanol, 95%, (3,5-Dibromo-4-isopropoxyphenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(3,5-dibromo-4-propan-2-yloxyphenyl)methanol (CAS 1696709-12-2) is a chemical compound with the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. IUPAC name: (3,5-dibromo-4-propan-2-yloxyphenyl)methanol. InChIKey: NNGRKHKYFFMTLV-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O2 |
|---|---|
| Molecular weight | 324.01 g/mol |
| IUPAC name | (3,5-dibromo-4-propan-2-yloxyphenyl)methanol |
| InChIKey | NNGRKHKYFFMTLV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)CO)Br |
Computed by PubChem (NCBI)