Products 26726-81-8
CAS 26726-81-8 appears in our catalog under these names: Pinaverium Impurity 8, 1,2-Bis(bromomethyl)-4,5-dimethoxybenzene, 95%, 1,2-Bis(bromomethyl)-4,5-dimethoxybenzene, 1,2-Bis(bromomethyl)-4,5-dimethoxybenzene 98%, 1,2-Bis(bromomethyl)-4,5-dimethoxybenzene, 98%, 98%. Offered by: Chemat Brand, Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: on request, 250mg, 1g, 5g, 750mg.
1,2-bis(bromomethyl)-4,5-dimethoxybenzene (CAS 26726-81-8) is a chemical compound with the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. IUPAC name: 1,2-bis(bromomethyl)-4,5-dimethoxybenzene. InChIKey: ARGOTHVUUGQGPD-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O2 |
|---|---|
| Molecular weight | 324.01 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)-4,5-dimethoxybenzene |
| InChIKey | ARGOTHVUUGQGPD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CBr)CBr)OC |
Computed by PubChem (NCBI)