CAS 6067-45-4 is the registry number for 1,2-BIS(4-NITROPHENYL)ETHANE-1,2-DIONE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,2-bis(4-nitrophenyl)ethane-1,2-dione (CAS 6067-45-4) is a chemical compound with the molecular formula C14H8N2O6 and a molecular weight of 300.22 g/mol. IUPAC name: 1,2-bis(4-nitrophenyl)ethane-1,2-dione. InChIKey: YRKNWVLBLGRGRK-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O6 |
|---|---|
| Molecular weight | 300.22 g/mol |
| IUPAC name | 1,2-bis(4-nitrophenyl)ethane-1,2-dione |
| InChIKey | YRKNWVLBLGRGRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)