CAS 5913-06-4 is the registry number for 1,2-Bis(3-nitrophenyl)ethane-1,2-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(3-nitrophenyl)ethane-1,2-dione (CAS 5913-06-4) is a chemical compound with the molecular formula C14H8N2O6 and a molecular weight of 300.22 g/mol. IUPAC name: 1,2-bis(3-nitrophenyl)ethane-1,2-dione. InChIKey: SGKVXDKTNJHBCA-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O6 |
|---|---|
| Molecular weight | 300.22 g/mol |
| IUPAC name | 1,2-bis(3-nitrophenyl)ethane-1,2-dione |
| InChIKey | SGKVXDKTNJHBCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)