Products 6067-45-4

CAS 6067-45-4 appears in our catalog under these names: 1,2-Bis(4-nitrophenyl)ethane-1,2-dione, 95%, 1,2-BIS(4-NITROPHENYL)ETHANE-1,2-DIONE, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

1,2-bis(4-nitrophenyl)ethane-1,2-dione (CAS 6067-45-4) is a chemical compound with the molecular formula C14H8N2O6 and a molecular weight of 300.22 g/mol. IUPAC name: 1,2-bis(4-nitrophenyl)ethane-1,2-dione. InChIKey: YRKNWVLBLGRGRK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8N2O6
Molecular weight300.22 g/mol
IUPAC name1,2-bis(4-nitrophenyl)ethane-1,2-dione
InChIKeyYRKNWVLBLGRGRK-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-]

Computed by PubChem (NCBI)