Products 4464-77-1
CAS 4464-77-1 appears in our catalog under these names: 1，2-Bis(furan-2-yl)ethane-1，2-diol, 95%, 95%, 1,2-Bis(2-furanyl)ethane-1,2-diol. Offered by: Chemat, Biosynth. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
1,2-bis(furan-2-yl)ethane-1,2-diol (CAS 4464-77-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 1,2-bis(furan-2-yl)ethane-1,2-diol. InChIKey: PAGAJWBCCKFHIT-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 1,2-bis(furan-2-yl)ethane-1,2-diol |
| InChIKey | PAGAJWBCCKFHIT-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(C(C2=CC=CO2)O)O |
Computed by PubChem (NCBI)
Synonyms:
1,2-Bis(furan-2-yl)ethane-1,2-diol, meso, 1,2-bis(furan-2-yl)ethane-1,2-diol, 1,2-Bis(2-furanyl)ethane-1,2-diol, Hydrofuroin, 1,2-Ethanediol, 1,2-di-2-furyl-, 1,2-Di(furan-2-yl)ethane-1,2-diol, 12-Bis(furan-2-yl)ethane-12-diol, 1,2-Bis(2-furanyl)ethylene glycol, 1,2-Bis(2-furyl)ethane-1,2-diol, 1,2-Bis(2-furanyl)-1,2-ethanediol