Products 102362-04-9
CAS 102362-04-9 appears in our catalog under these names: 4-Acetyl-2-methoxybenzoic acid, 95%, 4–Acetyl–2–methoxybenzoic acid, 4-Acetyl-2-methoxybenzoic acid 95%, 4-acetyl-2-methoxybenzoic acid, 97%, 97%, 4-Acetyl-2-methoxybenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
4-acetyl-2-methoxybenzoic acid (CAS 102362-04-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-acetyl-2-methoxybenzoic acid. InChIKey: OFDZQWIOLLRCOX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-acetyl-2-methoxybenzoic acid |
| InChIKey | OFDZQWIOLLRCOX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)