cas: 1682-06-0 — see every product listed under this CAS number, including other names
1,2-Dibromo-4-(trifluoromethoxy)benzene, 98+%, 98+% (CAS 1682-06-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112XWV-1g |
| cas | 1682-06-0 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 390.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
1,2-dibromo-4-(trifluoromethoxy)benzene (CAS 1682-06-0) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 1,2-dibromo-4-(trifluoromethoxy)benzene. InChIKey: TWWYCVQUIRYXRE-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 1,2-dibromo-4-(trifluoromethoxy)benzene |
| InChIKey | TWWYCVQUIRYXRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)Br |
Computed by PubChem (NCBI)