CAS 35852-57-4 appears in our catalog under these names: 2,6-Dibromo-4-trifluoromethylphenol, 2,6-Dibromo-4-(trifluoromethyl)phenol, 95%, 2,6-Dibromo-4-(trifluoromethyl)phenol 97%, 2,6-Dibromo-4-(trifluoromethyl)phenol, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg.
2,6-dibromo-4-(trifluoromethyl)phenol (CAS 35852-57-4) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 2,6-dibromo-4-(trifluoromethyl)phenol. InChIKey: IEMNQLAXBXXIKT-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 2,6-dibromo-4-(trifluoromethyl)phenol |
| InChIKey | IEMNQLAXBXXIKT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)