CAS 1804515-20-5 is the registry number for 1,3-Dibromo-2-difluoromethoxy-5-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,3-dibromo-2-(difluoromethoxy)-5-fluorobenzene (CAS 1804515-20-5) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 1,3-dibromo-2-(difluoromethoxy)-5-fluorobenzene. InChIKey: BXZWNZURMLKBCS-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 1,3-dibromo-2-(difluoromethoxy)-5-fluorobenzene |
| InChIKey | BXZWNZURMLKBCS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)OC(F)F)Br)F |
Computed by PubChem (NCBI)