cas: 6683-75-6 — see every product listed under this CAS number, including other names
1,2-Dibromo-4-tert-butylbenzene 95% (CAS 6683-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142827-1g |
| cas | 6683-75-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 459.38 Pln | |
| Ambeed | 100g | 1416.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142827 |
1,2-dibromo-4-tert-butylbenzene (CAS 6683-75-6) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,2-dibromo-4-tert-butylbenzene. InChIKey: LZOUMICSOKCMJT-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,2-dibromo-4-tert-butylbenzene |
| InChIKey | LZOUMICSOKCMJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)Br |
Computed by PubChem (NCBI)