CAS 1646-54-4 appears in our catalog under these names: 3,6-Dibromodurene, 98%, 1,4–Dibromo–2,3,5,6–tetramethylbenzene, 1,4-Dibromo-2,3,5,6-tetramethylbenzene, 1,4-Dibromo-2,3,5,6-tetramethylbenzene, >98.0%(GC), 1,4-Dibromo-2,3,5,6-tetramethylbenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 10g, 500g.
1,4-dibromo-2,3,5,6-tetramethylbenzene (CAS 1646-54-4) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,4-dibromo-2,3,5,6-tetramethylbenzene. InChIKey: IEWAQZBDJDWANM-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,4-dibromo-2,3,5,6-tetramethylbenzene |
| InChIKey | IEWAQZBDJDWANM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)C)C)Br)C |
Computed by PubChem (NCBI)