cas: 6683-75-6 — see every product listed under this CAS number, including other names
1,2-Dibromo-4-tert-butylbenzene, 95%, 95% (CAS 6683-75-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDTO-1g |
| cas | 6683-75-6 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 100g | 789.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,2-dibromo-4-tert-butylbenzene (CAS 6683-75-6) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,2-dibromo-4-tert-butylbenzene. InChIKey: LZOUMICSOKCMJT-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,2-dibromo-4-tert-butylbenzene |
| InChIKey | LZOUMICSOKCMJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)Br |
Computed by PubChem (NCBI)