cas: 139262-20-7 — see every product listed under this CAS number, including other names
1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(9H-fluoren-9-ylmethyl) ester, (2R,4S)-, 95%, 95% (CAS 139262-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ALJ-100mg |
| cas | 139262-20-7 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 563.60 Pln | |
| Chemat | 10g | 952.40 Pln | |
| Chemat | 25g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 139262-20-7) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: GOUUPUICWUFXPM-KPZWWZAWSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | GOUUPUICWUFXPM-KPZWWZAWSA-N |
| SMILES | C1[C@@H](CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)