Products 139262-20-7
CAS 139262-20-7 appears in our catalog under these names: Fmoc-trans-4-hydroxy-d-proline, 95%, Fmoc-trans-D-Hyp-OH 95%, 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(9H-fluoren-9-ylmethyl) ester, (2R,4S)-, 95%, 95%, (2R,4S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g, 10g.
(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 139262-20-7) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: GOUUPUICWUFXPM-KPZWWZAWSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | GOUUPUICWUFXPM-KPZWWZAWSA-N |
| SMILES | C1[C@@H](CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)