CAS 312965-04-1 appears in our catalog under these names: 4-(((9H-Fluoren-9-yl)methoxy)carbonyl)morpholine-2-carboxylic acid, 95%, Fmoc-Cop, >95% (HPLC), Fmoc-Cop-OH, 4-{((9H-fluoren-9-yl)methoxy)carbonyl}morpholine-2-carboxylic acid, Fmoc-COP 96%. Offered by: Combi-blocks, TRC, AmBeed, Iris Biotech, Biosynth. Available pack sizes: 250mg, 25g, 5g, 1g, 500mg, on request, 2,5g, 10g.
4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid (CAS 312965-04-1) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid. InChIKey: TUZVFPRISNDQLQ-UHFFFAOYSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)morpholine-2-carboxylic acid |
| InChIKey | TUZVFPRISNDQLQ-UHFFFAOYSA-N |
| SMILES | C1COC(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)