cas: 1288978-82-4 — see every product listed under this CAS number, including other names
1,3,2-DIOXABOROLANE,2-(4-FLUORO-2-NITROPHENYL)-4,4,5,5-TETRAMETHYL-, 97% (CAS 1288978-82-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334273-1G |
| cas | 1288978-82-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1356.83 Pln | |
| Fluorochem | 10g | 2653.25 Pln | |
| Fluorochem | 25g | 6537.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1288978-82-4) is a chemical compound with the molecular formula C12H15BFNO4 and a molecular weight of 267.06 g/mol. IUPAC name: 2-(4-fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UEMDKWBOUAQJJU-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO4 |
|---|---|
| Molecular weight | 267.06 g/mol |
| IUPAC name | 2-(4-fluoro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UEMDKWBOUAQJJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)