Products 1704080-43-2
CAS 1704080-43-2 is the registry number for (4–Fluoro–3–(4–hydroxypiperidine–1–carbonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 5g.
[4-fluoro-3-(4-hydroxypiperidine-1-carbonyl)phenyl]boronic acid (CAS 1704080-43-2) is a chemical compound with the molecular formula C12H15BFNO4 and a molecular weight of 267.06 g/mol. IUPAC name: [4-fluoro-3-(4-hydroxypiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: JWNZPTXJEUFQFR-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO4 |
|---|---|
| Molecular weight | 267.06 g/mol |
| IUPAC name | [4-fluoro-3-(4-hydroxypiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | JWNZPTXJEUFQFR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)N2CCC(CC2)O)(O)O |
Computed by PubChem (NCBI)