cas: 1599432-38-8 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 2-(2-chloro-6-fluorophenyl)-4,4,5,5-tetramethyl-, 98%, 98% (CAS 1599432-38-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RIN-250mg |
| cas | 1599432-38-8 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 554.00 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 10g | 880.40 Pln | |
| Chemat | 25g | 1701.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloro-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1599432-38-8) is a chemical compound with the molecular formula C12H15BClFO2 and a molecular weight of 256.51 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VKTLHYCBHWLRAO-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO2 |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VKTLHYCBHWLRAO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)