cas: 167693-19-8 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl- 98% (CAS 167693-19-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1123967-250mg |
| cas | 167693-19-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Ambeed | 5g | 7212.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1123967 |
2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 167693-19-8) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HMMQKSRJXWCQNW-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HMMQKSRJXWCQNW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCCC2 |
Computed by PubChem (NCBI)