cas: 167693-19-8 — see every product listed under this CAS number, including other names
2-(Cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96% (CAS 167693-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623949-100MG |
| cas | 167693-19-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 500mg | 1039.24 Pln | |
| Fluorochem | 1g | 1497.41 Pln | |
| Fluorochem | 5g | 7234.97 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 167693-19-8) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HMMQKSRJXWCQNW-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(cyclopentylidenemethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HMMQKSRJXWCQNW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCCC2 |
Computed by PubChem (NCBI)