CAS 141091-37-4 appears in our catalog under these names: Cyclohexen-1-ylboronic acid, pinacol ester, 97%, 1–Cyclohexen–1–yl–boronic acid pinacol ester, 2-(1-Cyclohexenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95.0%(GC), 1-Cyclohexenylboronic acid pinacol ester, 97%, 1-Cyclohexeneboronic acid pinacol ester 97%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 5g, 1g, 500MG, 250mg, 10g, 100g, 500g.
2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 141091-37-4) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QNZFUMVTUFOLRT-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QNZFUMVTUFOLRT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCCC2 |
Computed by PubChem (NCBI)