cas: 1813554-40-3 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-, 95%, 95% (CAS 1813554-40-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFYD-250mg |
| cas | 1813554-40-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 5g | 2627.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane (CAS 1813554-40-3) is a chemical compound with the molecular formula C20H22BF3O3 and a molecular weight of 378.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane. InChIKey: WWHKUPQIPGDPFH-UHFFFAOYSA-N.
| Molecular formula | C20H22BF3O3 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane |
| InChIKey | WWHKUPQIPGDPFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)