cas: 79023-51-1 — see every product listed under this CAS number, including other names
1,3,3-Trimethyl-3,4-dihydroisoquinoline, 97%, 97% (CAS 79023-51-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116NDU-100mg |
| cas | 79023-51-1 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 414.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3,3-trimethyl-4H-isoquinoline (CAS 79023-51-1) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 1,3,3-trimethyl-4H-isoquinoline. InChIKey: HFNOAVXTUXLYNM-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 1,3,3-trimethyl-4H-isoquinoline |
| InChIKey | HFNOAVXTUXLYNM-UHFFFAOYSA-N |
| SMILES | CC1=NC(CC2=CC=CC=C12)(C)C |
Computed by PubChem (NCBI)