CAS 25981-82-2 appears in our catalog under these names: 2,3,3,5-Tetramethylindolenine, 96%, 2,3,3,5-Tetramethyl-3H-indole, 98%, 2,3,3,5-Tetramethylindolenine, 94% , 2,3,3,5-Tetramethylindolenine, >98.0%(GC), 3H-Indole, 2,3,3,5-tetramethyl-, 97%, 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 100g.
2,3,3,5-tetramethylindole (CAS 25981-82-2) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 2,3,3,5-tetramethylindole. InChIKey: RQVAPBRSUHSDGP-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 2,3,3,5-tetramethylindole |
| InChIKey | RQVAPBRSUHSDGP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C2(C)C)C |
Computed by PubChem (NCBI)