CAS 480436-44-0 appears in our catalog under these names: 7-(tert-Butyl)-1h-indole, 95%, 7–(tert–Butyl)–1H–indole, 7-(tert-Butyl)-1H-indole, 97%, 97%, 7-(tert-Butyl)-1H-indole, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
7-tert-butyl-1H-indole (CAS 480436-44-0) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 7-tert-butyl-1H-indole. InChIKey: NZZQQDKASZDKJQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 7-tert-butyl-1H-indole |
| InChIKey | NZZQQDKASZDKJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC2=C1NC=C2 |
Computed by PubChem (NCBI)