CAS 25871-69-6 appears in our catalog under these names: 1,3,5-Tribenzoylbenzene, 95%, Benzene–1,3,5–triyltris(phenylmethanone), Benzene-1,3,5-triyltris(phenylmethanone), 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
(3,5-dibenzoylphenyl)-phenylmethanone (CAS 25871-69-6) is a chemical compound with the molecular formula C27H18O3 and a molecular weight of 390.4 g/mol. IUPAC name: (3,5-dibenzoylphenyl)-phenylmethanone. InChIKey: FDSRSUAVHPFWGT-UHFFFAOYSA-N.
| Molecular formula | C27H18O3 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | (3,5-dibenzoylphenyl)-phenylmethanone |
| InChIKey | FDSRSUAVHPFWGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC(=C2)C(=O)C3=CC=CC=C3)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)