cas: 33170-68-2 — see every product listed under this CAS number, including other names
1,3-Bis(4-bromophenyl)propane-1,3-dione, 97% (CAS 33170-68-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A800965-10g |
| cas | 33170-68-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10206.07 Pln | |
| Fluorochem | 50mg | 200.99 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 500mg | 612.30 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 2.5g | 2106.57 Pln | |
| Fluorochem | 5g | 3080.18 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-bis(4-bromophenyl)propane-1,3-dione (CAS 33170-68-2) is a chemical compound with the molecular formula C15H10Br2O2 and a molecular weight of 382.05 g/mol. IUPAC name: 1,3-bis(4-bromophenyl)propane-1,3-dione. InChIKey: HOVMFCOUXZBNBX-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O2 |
|---|---|
| Molecular weight | 382.05 g/mol |
| IUPAC name | 1,3-bis(4-bromophenyl)propane-1,3-dione |
| InChIKey | HOVMFCOUXZBNBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)