CAS 16619-55-9 appears in our catalog under these names: 2,2-Dibromo-1,3-diphenyl-1,3-propanedione, 98%, 2,2–Dibromo–1,3–diphenyl–1,3–propanedione, 2,2-Dibromo-1,3-diphenyl-1,3-propanedione, >98.0%(T), 2,2-Dibromo-1,3-diphenylpropane-1,3-dione, 98%, 98%, 2,2-Dibromo-1,3-diphenylpropane-1,3-dione, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 25g.
2,2-dibromo-1,3-diphenylpropane-1,3-dione (CAS 16619-55-9) is a chemical compound with the molecular formula C15H10Br2O2 and a molecular weight of 382.05 g/mol. IUPAC name: 2,2-dibromo-1,3-diphenylpropane-1,3-dione. InChIKey: GSWSUDFFJVJMLG-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O2 |
|---|---|
| Molecular weight | 382.05 g/mol |
| IUPAC name | 2,2-dibromo-1,3-diphenylpropane-1,3-dione |
| InChIKey | GSWSUDFFJVJMLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(=O)C2=CC=CC=C2)(Br)Br |
Computed by PubChem (NCBI)