CAS 33170-68-2 appears in our catalog under these names: 1,3-Bis(4-bromophenyl)propane-1,3-dione, 97%, 1,3-Bis(4-bromophenyl)propane-1,3-dione 95%, 1,3-Bis(4-bromophenyl)propane-1,3-dione, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 50mg, 500mg, 2.5g.
1,3-bis(4-bromophenyl)propane-1,3-dione (CAS 33170-68-2) is a chemical compound with the molecular formula C15H10Br2O2 and a molecular weight of 382.05 g/mol. IUPAC name: 1,3-bis(4-bromophenyl)propane-1,3-dione. InChIKey: HOVMFCOUXZBNBX-UHFFFAOYSA-N.
| Molecular formula | C15H10Br2O2 |
|---|---|
| Molecular weight | 382.05 g/mol |
| IUPAC name | 1,3-bis(4-bromophenyl)propane-1,3-dione |
| InChIKey | HOVMFCOUXZBNBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)