cas: 1227-45-8 — see every product listed under this CAS number, including other names
1,3-Bis(4-methoxyphenyl)thiourea, 98% (CAS 1227-45-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F462027-5G |
| cas | 1227-45-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 758.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,3-bis(4-methoxyphenyl)thiourea (CAS 1227-45-8) is a chemical compound with the molecular formula C15H16N2O2S and a molecular weight of 288.4 g/mol. IUPAC name: 1,3-bis(4-methoxyphenyl)thiourea. InChIKey: RGRJEERVXALLTH-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 1,3-bis(4-methoxyphenyl)thiourea |
| InChIKey | RGRJEERVXALLTH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=S)NC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)