Products 1160573-82-9
CAS 1160573-82-9 appears in our catalog under these names: 1,3-Dibromo-2-chloro-5-ethylbenzene, ≥95%, ≥95%, 1,3-DIBROMO-2-CHLORO-5-ETHYLBENZENE, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
1,3-dibromo-2-chloro-5-ethylbenzene (CAS 1160573-82-9) is a chemical compound with the molecular formula C8H7Br2Cl and a molecular weight of 298.40 g/mol. IUPAC name: 1,3-dibromo-2-chloro-5-ethylbenzene. InChIKey: OEZLMCZHBVJXEG-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2Cl |
|---|---|
| Molecular weight | 298.40 g/mol |
| IUPAC name | 1,3-dibromo-2-chloro-5-ethylbenzene |
| InChIKey | OEZLMCZHBVJXEG-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)Br)Cl)Br |
Computed by PubChem (NCBI)