Products 23135-16-2

CAS 23135-16-2 is the registry number for 1-Chloro-4-(1,2-dibromoethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 100g, 5g.

Structural formula: {0} (CAS {1})

1-chloro-4-(1,2-dibromoethyl)benzene (CAS 23135-16-2) is a chemical compound with the molecular formula C8H7Br2Cl and a molecular weight of 298.40 g/mol. IUPAC name: 1-chloro-4-(1,2-dibromoethyl)benzene. InChIKey: LBLPNCDPGCZTRP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7Br2Cl
Molecular weight298.40 g/mol
IUPAC name1-chloro-4-(1,2-dibromoethyl)benzene
InChIKeyLBLPNCDPGCZTRP-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CBr)Br)Cl

Computed by PubChem (NCBI)