CAS 2756181-24-3 is the registry number for 2,3-dibromo-1-chloro-4,5-dimethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dibromo-1-chloro-4,5-dimethylbenzene (CAS 2756181-24-3) is a chemical compound with the molecular formula C8H7Br2Cl and a molecular weight of 298.40 g/mol. IUPAC name: 2,3-dibromo-1-chloro-4,5-dimethylbenzene. InChIKey: YTPBKWZOGIILRC-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2Cl |
|---|---|
| Molecular weight | 298.40 g/mol |
| IUPAC name | 2,3-dibromo-1-chloro-4,5-dimethylbenzene |
| InChIKey | YTPBKWZOGIILRC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)Br)Br)Cl |
Computed by PubChem (NCBI)