cas: 550378-78-4 — see every product listed under this CAS number, including other names
1,3-Di(9H-carbazol-9-yl)benzene, 96%, 96% (CAS 550378-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114839-100mg |
| cas | 550378-78-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 429.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
9-(3-carbazol-9-ylphenyl)carbazole (CAS 550378-78-4) is a chemical compound with the molecular formula C30H20N2 and a molecular weight of 408.5 g/mol. IUPAC name: 9-(3-carbazol-9-ylphenyl)carbazole. InChIKey: MZYDBGLUVPLRKR-UHFFFAOYSA-N.
| Molecular formula | C30H20N2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 9-(3-carbazol-9-ylphenyl)carbazole |
| InChIKey | MZYDBGLUVPLRKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC(=CC=C4)N5C6=CC=CC=C6C7=CC=CC=C75 |
Computed by PubChem (NCBI)