CAS 2446434-80-4 is the registry number for 5-([1,1'-Biphenyl]-4-yl)-5,7-dihydroindolo[2,3-b]carbazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-phenylphenyl)-7H-indolo[2,3-b]carbazole (CAS 2446434-80-4) is a chemical compound with the molecular formula C30H20N2 and a molecular weight of 408.5 g/mol. IUPAC name: 5-(4-phenylphenyl)-7H-indolo[2,3-b]carbazole. InChIKey: JUMVYQXYWJTKDL-UHFFFAOYSA-N.
| Molecular formula | C30H20N2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 5-(4-phenylphenyl)-7H-indolo[2,3-b]carbazole |
| InChIKey | JUMVYQXYWJTKDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=CC=CC=C4C5=C3C=C6C(=C5)C7=CC=CC=C7N6 |
Computed by PubChem (NCBI)