CAS 58328-30-6 appears in our catalog under these names: 5,11-Diphenyl-5,11-dihydroindolo[3,2-b]carbazole, 97%, 97%, Indolo[3,2-b]carbazole, 5,11-dihydro-5,11-diphenyl-, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g, 10g.
5,11-diphenylindolo[3,2-b]carbazole (CAS 58328-30-6) is a chemical compound with the molecular formula C30H20N2 and a molecular weight of 408.5 g/mol. IUPAC name: 5,11-diphenylindolo[3,2-b]carbazole. InChIKey: WKAHKYDYDUMBRW-UHFFFAOYSA-N.
| Molecular formula | C30H20N2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 5,11-diphenylindolo[3,2-b]carbazole |
| InChIKey | WKAHKYDYDUMBRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C4=CC5=C(C=C42)C6=CC=CC=C6N5C7=CC=CC=C7 |
Computed by PubChem (NCBI)