cas: 206347-32-2 — see every product listed under this CAS number, including other names
1,3-Dibromo-2-(2-bromoethoxy)benzene, 95%, 95% (CAS 206347-32-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IG1-100mg |
| cas | 206347-32-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1101.20 Pln | |
| Chemat | 1g | 1797.20 Pln | |
| Chemat | 5g | 5272.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-2-(2-bromoethoxy)benzene (CAS 206347-32-2) is a chemical compound with the molecular formula C8H7Br3O and a molecular weight of 358.85 g/mol. IUPAC name: 1,3-dibromo-2-(2-bromoethoxy)benzene. InChIKey: GGANKCYHHSNNJR-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3O |
|---|---|
| Molecular weight | 358.85 g/mol |
| IUPAC name | 1,3-dibromo-2-(2-bromoethoxy)benzene |
| InChIKey | GGANKCYHHSNNJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OCCBr)Br |
Computed by PubChem (NCBI)